| Name | ethyl 2-cyanopyridine-4-carboxylate |
| Synonyms | Ethyl 2-cyanoiso Ethyl 2-cyanoisonicotite Ethyl 2-cyanoisonicotinate ethyl 2-cyanopyridine-4-carboxylate 2-Cyanoisonicotinic acid ethyl ester 2-Cyano-4-pyridinecarboxylic Acid Ethyl Ester 4-pyridinecarboxylic acid, 2-cyano-, ethyl ester 4-Pyridinecarboxylic acid, 2-cyano-, ethyl ester |
| CAS | 58481-14-4 |
| InChI | InChI=1/C9H8N2O2/c1-2-13-9(12)7-3-4-11-8(5-7)6-10/h3-5H,2H2,1H3 |
| Molecular Formula | C9H8N2O2 |
| Molar Mass | 176.17 |
| Density | 1.21 |
| Melting Point | 42-44℃ |
| Boling Point | 308.616°C at 760 mmHg |
| Flash Point | 140.446°C |
| Vapor Presure | 0.001mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.529 |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | 3439 |
| HS Code | 29333990 |